C15H18O4S — CID 139121020
(4aS,7R,7aS)-7-(benzenesulfonyl)-7a-methoxy-3,4,4a,7-tetrahydro-2H-cyclopenta[b]pyran (PubChem CID 139121020) has the molecular formula C15H18O4S and a molecular weight of 294.37 g/mol. Its IUPAC name is (4aS,7R,7aS)-7-(benzenesulfonyl)-7a-methoxy-3,4,4a,7-tetrahydro-2H-cyclopenta[b]pyran.
| Compound Name | (4aS,7R,7aS)-7-(benzenesulfonyl)-7a-methoxy-3,4,4a,7-tetrahydro-2H-cyclopenta[b]pyran |
|---|---|
| PubChem CID | 139121020 |
| Molecular Formula | C15H18O4S |
| Molecular Weight | 294.37 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | (4aS,7R,7aS)-7-(benzenesulfonyl)-7a-methoxy-3,4,4a,7-tetrahydro-2H-cyclopenta[b]pyran |
| SMILES | CO[C@]12OCCC[C@H]1C=C[C@H]2S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C15H18O4S/c1-18-15-12(6-5-11-19-15)9-10-14(15)20(16,17)13-7-3-2-4-8-13/h2-4,7-10,12,14H,5-6,11H2,1H3/t12-,14+,15-/m0/s1 |
| InChIKey | WNKIDMBAUZQBQX-CFVMTHIKSA-N |
| XLogP | 2.17 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.37 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|