C21H30O6S3 — CID 583684
[2,2-dimethyl-4-[(2-methyl-1,3-dithian-2-yl)methyl]-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl] 4-methylbenzenesulfonate (PubChem CID 583684) has the molecular formula C21H30O6S3 and a molecular weight of 474.67 g/mol. Its IUPAC name is [2,2-dimethyl-4-[(2-methyl-1,3-dithian-2-yl)methyl]-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl] 4-methylbenzenesulfonate.
| Compound Name | [2,2-dimethyl-4-[(2-methyl-1,3-dithian-2-yl)methyl]-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 583684 |
| Molecular Formula | C21H30O6S3 |
| Molecular Weight | 474.67 g/mol |
| Exact Mass | 474.12 |
| IUPAC Name | [2,2-dimethyl-4-[(2-methyl-1,3-dithian-2-yl)methyl]-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC2COC(CC3(C)SCCCS3)C3OC(C)(C)OC23)cc1 |
| InChI | InChI=1S/C21H30O6S3/c1-14-6-8-15(9-7-14)30(22,23)27-17-13-24-16(12-21(4)28-10-5-11-29-21)18-19(17)26-20(2,3)25-18/h6-9,16-19H,5,10-13H2,1-4H3 |
| InChIKey | FKVIGDOMTTUFJS-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.67 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|