C18H28O6S — CID 134832631
[(2S,4R,6S)-4-(methoxymethoxy)-6-propyloxan-2-yl]methyl 4-methylbenzenesulfonate (PubChem CID 134832631) has the molecular formula C18H28O6S and a molecular weight of 372.48 g/mol. Its IUPAC name is [(2S,4R,6S)-4-(methoxymethoxy)-6-propyloxan-2-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [(2S,4R,6S)-4-(methoxymethoxy)-6-propyloxan-2-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 134832631 |
| Molecular Formula | C18H28O6S |
| Molecular Weight | 372.48 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | [(2S,4R,6S)-4-(methoxymethoxy)-6-propyloxan-2-yl]methyl 4-methylbenzenesulfonate |
| SMILES | CCC[C@H]1C[C@@H](OCOC)C[C@@H](COS(=O)(=O)c2ccc(C)cc2)O1 |
| InChI | InChI=1S/C18H28O6S/c1-4-5-15-10-16(22-13-21-3)11-17(24-15)12-23-25(19,20)18-8-6-14(2)7-9-18/h6-9,15-17H,4-5,10-13H2,1-3H3/t15-,16+,17-/m0/s1 |
| InChIKey | HFMXCAVPSHXWHU-BBWFWOEESA-N |
| XLogP | 3.04 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.48 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|