C21H24O8S2 — CID 11317315
[(4R,5R)-5-[(2R,3R)-3-(benzenesulfonyl)oxiran-2-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]methyl 4-methylbenzenesulfonate (PubChem CID 11317315) has the molecular formula C21H24O8S2 and a molecular weight of 468.55 g/mol. Its IUPAC name is [(4R,5R)-5-[(2R,3R)-3-(benzenesulfonyl)oxiran-2-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [(4R,5R)-5-[(2R,3R)-3-(benzenesulfonyl)oxiran-2-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 11317315 |
| Molecular Formula | C21H24O8S2 |
| Molecular Weight | 468.55 g/mol |
| Exact Mass | 468.09 |
| IUPAC Name | [(4R,5R)-5-[(2R,3R)-3-(benzenesulfonyl)oxiran-2-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@H]2OC(C)(C)O[C@H]2[C@H]2O[C@@H]2S(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C21H24O8S2/c1-14-9-11-16(12-10-14)31(24,25)26-13-17-18(29-21(2,3)28-17)19-20(27-19)30(22,23)15-7-5-4-6-8-15/h4-12,17-20H,13H2,1-3H3/t17-,18-,19-,20-/m1/s1 |
| InChIKey | DLANIEQZYHYJEL-UAFMIMERSA-N |
| XLogP | 2.42 |
| TPSA | 108.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.55 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|