C15H18O4S2 — CID 561951
2-oxa-7-thiatricyclo[4.4.0.03,8]decan-4-yl 4-methylbenzenesulfonate (PubChem CID 561951) has the molecular formula C15H18O4S2 and a molecular weight of 326.44 g/mol. Its IUPAC name is 2-oxa-7-thiatricyclo[4.4.0.03,8]decan-4-yl 4-methylbenzenesulfonate.
| Compound Name | 2-oxa-7-thiatricyclo[4.4.0.03,8]decan-4-yl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 561951 |
| Molecular Formula | C15H18O4S2 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.06 |
| IUPAC Name | 2-oxa-7-thiatricyclo[4.4.0.03,8]decan-4-yl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC2CC3SC4CCC3OC24)cc1 |
| InChI | InChI=1S/C15H18O4S2/c1-9-2-4-10(5-3-9)21(16,17)19-12-8-14-11-6-7-13(20-14)15(12)18-11/h2-5,11-15H,6-8H2,1H3 |
| InChIKey | XEBMACXNXKVABP-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|