C13H18O4S — CID 102471470
(2R,3R)-2-[(4-methylphenyl)sulfonylmethyl]oxan-3-ol (PubChem CID 102471470) has the molecular formula C13H18O4S and a molecular weight of 270.35 g/mol. Its IUPAC name is (2R,3R)-2-[(4-methylphenyl)sulfonylmethyl]oxan-3-ol.
| Compound Name | (2R,3R)-2-[(4-methylphenyl)sulfonylmethyl]oxan-3-ol |
|---|---|
| PubChem CID | 102471470 |
| Molecular Formula | C13H18O4S |
| Molecular Weight | 270.35 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | (2R,3R)-2-[(4-methylphenyl)sulfonylmethyl]oxan-3-ol |
| SMILES | Cc1ccc(S(=O)(=O)C[C@@H]2OCCC[C@H]2O)cc1 |
| InChI | InChI=1S/C13H18O4S/c1-10-4-6-11(7-5-10)18(15,16)9-13-12(14)3-2-8-17-13/h4-7,12-14H,2-3,8-9H2,1H3/t12-,13+/m1/s1 |
| InChIKey | FZFROMVINFQPPX-OLZOCXBDSA-N |
| XLogP | 1.31 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.35 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |