C16H24O3S — CID 10935345
(2S,6R)-2-[(4-methylphenyl)sulfonylmethyl]-6-propan-2-yloxane (PubChem CID 10935345) has the molecular formula C16H24O3S and a molecular weight of 296.43 g/mol. Its IUPAC name is (2S,6R)-2-[(4-methylphenyl)sulfonylmethyl]-6-propan-2-yloxane.
| Compound Name | (2S,6R)-2-[(4-methylphenyl)sulfonylmethyl]-6-propan-2-yloxane |
|---|---|
| PubChem CID | 10935345 |
| Molecular Formula | C16H24O3S |
| Molecular Weight | 296.43 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | (2S,6R)-2-[(4-methylphenyl)sulfonylmethyl]-6-propan-2-yloxane |
| SMILES | Cc1ccc(S(=O)(=O)C[C@@H]2CCC[C@H](C(C)C)O2)cc1 |
| InChI | InChI=1S/C16H24O3S/c1-12(2)16-6-4-5-14(19-16)11-20(17,18)15-9-7-13(3)8-10-15/h7-10,12,14,16H,4-6,11H2,1-3H3/t14-,16+/m0/s1 |
| InChIKey | CYYYZCUJBLQEQU-GOEBONIOSA-N |
| XLogP | 3.36 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.43 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |