C16H24O2S — CID 12501851
S-tert-butyl (2R,3R)-3-hydroxy-2-methyl-5-phenylpentanethioate (PubChem CID 12501851) has the molecular formula C16H24O2S and a molecular weight of 280.43 g/mol. Its IUPAC name is S-tert-butyl (2R,3R)-3-hydroxy-2-methyl-5-phenylpentanethioate.
| Compound Name | S-tert-butyl (2R,3R)-3-hydroxy-2-methyl-5-phenylpentanethioate |
|---|---|
| PubChem CID | 12501851 |
| Molecular Formula | C16H24O2S |
| Molecular Weight | 280.43 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | S-tert-butyl (2R,3R)-3-hydroxy-2-methyl-5-phenylpentanethioate |
| SMILES | C[C@@H](C(=O)SC(C)(C)C)[C@H](O)CCc1ccccc1 |
| InChI | InChI=1S/C16H24O2S/c1-12(15(18)19-16(2,3)4)14(17)11-10-13-8-6-5-7-9-13/h5-9,12,14,17H,10-11H2,1-4H3/t12-,14-/m1/s1 |
| InChIKey | XBJGNVOHPIOFEV-TZMCWYRMSA-N |
| XLogP | 3.67 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.43 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|