C25H34O3SSi — CID 134925558
1-[(4S)-4-[tert-butyl(diphenyl)silyl]oxy-1-oxothian-2-yl]-2-methylpropan-1-one (PubChem CID 134925558) has the molecular formula C25H34O3SSi and a molecular weight of 442.70 g/mol. Its IUPAC name is 1-[(4S)-4-[tert-butyl(diphenyl)silyl]oxy-1-oxothian-2-yl]-2-methylpropan-1-one.
| Compound Name | 1-[(4S)-4-[tert-butyl(diphenyl)silyl]oxy-1-oxothian-2-yl]-2-methylpropan-1-one |
|---|---|
| PubChem CID | 134925558 |
| Molecular Formula | C25H34O3SSi |
| Molecular Weight | 442.70 g/mol |
| Exact Mass | 442.20 |
| IUPAC Name | 1-[(4S)-4-[tert-butyl(diphenyl)silyl]oxy-1-oxothian-2-yl]-2-methylpropan-1-one |
| SMILES | CC(C)C(=O)C1C[C@@H](O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)CCS1=O |
| InChI | InChI=1S/C25H34O3SSi/c1-19(2)24(26)23-18-20(16-17-29(23)27)28-30(25(3,4)5,21-12-8-6-9-13-21)22-14-10-7-11-15-22/h6-15,19-20,23H,16-18H2,1-5H3/t20-,23?,29?/m0/s1 |
| InChIKey | PDEAGMQLNFGVMR-NNIWKDTMSA-N |
| XLogP | 4.07 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.70 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|