C27H50O2SSi2 — CID 46944407
S-ethyl (3S,5S,7S)-7-[tert-butyl(dimethyl)silyl]oxy-5-[dimethyl(phenyl)silyl]-3-methyldecanethioate (PubChem CID 46944407) has the molecular formula C27H50O2SSi2 and a molecular weight of 494.93 g/mol. Its IUPAC name is S-ethyl (3S,5S,7S)-7-[tert-butyl(dimethyl)silyl]oxy-5-[dimethyl(phenyl)silyl]-3-methyldecanethioate.
| Compound Name | S-ethyl (3S,5S,7S)-7-[tert-butyl(dimethyl)silyl]oxy-5-[dimethyl(phenyl)silyl]-3-methyldecanethioate |
|---|---|
| PubChem CID | 46944407 |
| Molecular Formula | C27H50O2SSi2 |
| Molecular Weight | 494.93 g/mol |
| Exact Mass | 494.31 |
| IUPAC Name | S-ethyl (3S,5S,7S)-7-[tert-butyl(dimethyl)silyl]oxy-5-[dimethyl(phenyl)silyl]-3-methyldecanethioate |
| SMILES | CCC[C@@H](C[C@H](C[C@H](C)CC(=O)SCC)[Si](C)(C)c1ccccc1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H50O2SSi2/c1-11-16-23(29-32(9,10)27(4,5)6)21-25(19-22(3)20-26(28)30-12-2)31(7,8)24-17-14-13-15-18-24/h13-15,17-18,22-23,25H,11-12,16,19-21H2,1-10H3/t22-,23-,25-/m0/s1 |
| InChIKey | GXADCSPQQPCICJ-LSQMVHIFSA-N |
| XLogP | 8.25 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.93 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|