C26H38O2SSi — CID 175678471
S-ethyl (3S,5S)-6-[tert-butyl(diphenyl)silyl]oxy-3,5-dimethylhexanethioate (PubChem CID 175678471) has the molecular formula C26H38O2SSi and a molecular weight of 442.74 g/mol. Its IUPAC name is S-ethyl (3S,5S)-6-[tert-butyl(diphenyl)silyl]oxy-3,5-dimethylhexanethioate.
| Compound Name | S-ethyl (3S,5S)-6-[tert-butyl(diphenyl)silyl]oxy-3,5-dimethylhexanethioate |
|---|---|
| PubChem CID | 175678471 |
| Molecular Formula | C26H38O2SSi |
| Molecular Weight | 442.74 g/mol |
| Exact Mass | 442.24 |
| IUPAC Name | S-ethyl (3S,5S)-6-[tert-butyl(diphenyl)silyl]oxy-3,5-dimethylhexanethioate |
| SMILES | CCSC(=O)C[C@@H](C)C[C@H](C)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C26H38O2SSi/c1-7-29-25(27)19-21(2)18-22(3)20-28-30(26(4,5)6,23-14-10-8-11-15-23)24-16-12-9-13-17-24/h8-17,21-22H,7,18-20H2,1-6H3/t21-,22-/m0/s1 |
| InChIKey | URMAXXGVOLOWRB-VXKWHMMOSA-N |
| XLogP | 5.90 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.74 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|