C27H40O2Si — CID 11101968
(3S,7R)-7-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-methylnonan-2-one (PubChem CID 11101968) has the molecular formula C27H40O2Si and a molecular weight of 424.70 g/mol. Its IUPAC name is (3S,7R)-7-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-methylnonan-2-one.
| Compound Name | (3S,7R)-7-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-methylnonan-2-one |
|---|---|
| PubChem CID | 11101968 |
| Molecular Formula | C27H40O2Si |
| Molecular Weight | 424.70 g/mol |
| Exact Mass | 424.28 |
| IUPAC Name | (3S,7R)-7-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-methylnonan-2-one |
| SMILES | CC[C@H](CCC[C@H](C)C(C)=O)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C27H40O2Si/c1-7-24(16-14-15-22(2)23(3)28)21-29-30(27(4,5)6,25-17-10-8-11-18-25)26-19-12-9-13-20-26/h8-13,17-20,22,24H,7,14-16,21H2,1-6H3/t22-,24+/m0/s1 |
| InChIKey | CZONTELBBIBIKY-LADGPHEKSA-N |
| XLogP | 5.98 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.70 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|