C24H40O2Si — CID 134954625
(2R,3S,4S)-3-butyl-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-methyl-2-phenylcyclohexan-1-one (PubChem CID 134954625) has the molecular formula C24H40O2Si and a molecular weight of 388.67 g/mol. Its IUPAC name is (2R,3S,4S)-3-butyl-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-methyl-2-phenylcyclohexan-1-one.
| Compound Name | (2R,3S,4S)-3-butyl-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-methyl-2-phenylcyclohexan-1-one |
|---|---|
| PubChem CID | 134954625 |
| Molecular Formula | C24H40O2Si |
| Molecular Weight | 388.67 g/mol |
| Exact Mass | 388.28 |
| IUPAC Name | (2R,3S,4S)-3-butyl-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-methyl-2-phenylcyclohexan-1-one |
| SMILES | CCCC[C@H]1[C@H](c2ccccc2)C(=O)CC[C@]1(C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H40O2Si/c1-8-9-15-20-22(19-13-11-10-12-14-19)21(25)16-17-24(20,5)18-26-27(6,7)23(2,3)4/h10-14,20,22H,8-9,15-18H2,1-7H3/t20-,22-,24+/m0/s1 |
| InChIKey | DEXPLHUJGHWTDG-ODGPQVTHSA-N |
| XLogP | 6.97 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.67 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|