C35H36O3SSi — CID 139608710
3-(4-methoxy-3-methyl-2-phenylsulfanylbut-3-en-2-yl)-4-triphenylsilyloxycyclopentan-1-one (PubChem CID 139608710) has the molecular formula C35H36O3SSi and a molecular weight of 564.82 g/mol. Its IUPAC name is 3-(4-methoxy-3-methyl-2-phenylsulfanylbut-3-en-2-yl)-4-triphenylsilyloxycyclopentan-1-one.
| Compound Name | 3-(4-methoxy-3-methyl-2-phenylsulfanylbut-3-en-2-yl)-4-triphenylsilyloxycyclopentan-1-one |
|---|---|
| PubChem CID | 139608710 |
| Molecular Formula | C35H36O3SSi |
| Molecular Weight | 564.82 g/mol |
| Exact Mass | 564.22 |
| IUPAC Name | 3-(4-methoxy-3-methyl-2-phenylsulfanylbut-3-en-2-yl)-4-triphenylsilyloxycyclopentan-1-one |
| SMILES | COC=C(C)C(C)(Sc1ccccc1)C1CC(=O)CC1O[Si](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C35H36O3SSi/c1-27(26-37-3)35(2,39-29-16-8-4-9-17-29)33-24-28(36)25-34(33)38-40(30-18-10-5-11-19-30,31-20-12-6-13-21-31)32-22-14-7-15-23-32/h4-23,26,33-34H,24-25H2,1-3H3 |
| InChIKey | OIUDLSBJPQTDJF-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.82 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|