C36H42O5SSi — CID 11061125
[4-(benzenesulfonyl)-6-[tert-butyl(diphenyl)silyl]oxy-1-phenylhexan-3-yl] acetate (PubChem CID 11061125) has the molecular formula C36H42O5SSi and a molecular weight of 614.88 g/mol. Its IUPAC name is [4-(benzenesulfonyl)-6-[tert-butyl(diphenyl)silyl]oxy-1-phenylhexan-3-yl] acetate.
| Compound Name | [4-(benzenesulfonyl)-6-[tert-butyl(diphenyl)silyl]oxy-1-phenylhexan-3-yl] acetate |
|---|---|
| PubChem CID | 11061125 |
| Molecular Formula | C36H42O5SSi |
| Molecular Weight | 614.88 g/mol |
| Exact Mass | 614.25 |
| IUPAC Name | [4-(benzenesulfonyl)-6-[tert-butyl(diphenyl)silyl]oxy-1-phenylhexan-3-yl] acetate |
| SMILES | CC(=O)OC(CCc1ccccc1)C(CCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C36H42O5SSi/c1-29(37)41-34(26-25-30-17-9-5-10-18-30)35(42(38,39)31-19-11-6-12-20-31)27-28-40-43(36(2,3)4,32-21-13-7-14-22-32)33-23-15-8-16-24-33/h5-24,34-35H,25-28H2,1-4H3 |
| InChIKey | GEGNQOJXTLKHST-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.88 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|