C28H34O3SSi — CID 10961819
[(1S,6R)-2-(benzenesulfonyl)-2-benzyl-6-methoxycyclohexyl]-dimethyl-phenylsilane (PubChem CID 10961819) has the molecular formula C28H34O3SSi and a molecular weight of 478.73 g/mol. Its IUPAC name is [(1S,6R)-2-(benzenesulfonyl)-2-benzyl-6-methoxycyclohexyl]-dimethyl-phenylsilane.
| Compound Name | [(1S,6R)-2-(benzenesulfonyl)-2-benzyl-6-methoxycyclohexyl]-dimethyl-phenylsilane |
|---|---|
| PubChem CID | 10961819 |
| Molecular Formula | C28H34O3SSi |
| Molecular Weight | 478.73 g/mol |
| Exact Mass | 478.20 |
| IUPAC Name | [(1S,6R)-2-(benzenesulfonyl)-2-benzyl-6-methoxycyclohexyl]-dimethyl-phenylsilane |
| SMILES | CO[C@@H]1CCCC(Cc2ccccc2)(S(=O)(=O)c2ccccc2)[C@H]1[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C28H34O3SSi/c1-31-26-20-13-21-28(22-23-14-7-4-8-15-23,32(29,30)24-16-9-5-10-17-24)27(26)33(2,3)25-18-11-6-12-19-25/h4-12,14-19,26-27H,13,20-22H2,1-3H3/t26-,27+,28?/m1/s1 |
| InChIKey | XHQWRIPVMDQGLJ-ANUFDVCNSA-N |
| XLogP | 5.63 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.73 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|