C22H26O3S — CID 139704076
2-(benzenesulfonyl)-3-cyclohexyl-2-(2-phenylethyl)oxirane (PubChem CID 139704076) has the molecular formula C22H26O3S and a molecular weight of 370.51 g/mol. Its IUPAC name is 2-(benzenesulfonyl)-3-cyclohexyl-2-(2-phenylethyl)oxirane.
| Compound Name | 2-(benzenesulfonyl)-3-cyclohexyl-2-(2-phenylethyl)oxirane |
|---|---|
| PubChem CID | 139704076 |
| Molecular Formula | C22H26O3S |
| Molecular Weight | 370.51 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | 2-(benzenesulfonyl)-3-cyclohexyl-2-(2-phenylethyl)oxirane |
| SMILES | O=S(=O)(c1ccccc1)C1(CCc2ccccc2)OC1C1CCCCC1 |
| InChI | InChI=1S/C22H26O3S/c23-26(24,20-14-8-3-9-15-20)22(17-16-18-10-4-1-5-11-18)21(25-22)19-12-6-2-7-13-19/h1,3-5,8-11,14-15,19,21H,2,6-7,12-13,16-17H2 |
| InChIKey | WUPHRNBDRLBCCA-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 46.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.51 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|