C21H22F2O3S — CID 153404234
4-[1-[4-(2,4-difluorophenyl)phenyl]sulfonylcyclopropyl]cyclohexan-1-ol (PubChem CID 153404234) has the molecular formula C21H22F2O3S and a molecular weight of 392.47 g/mol. Its IUPAC name is 4-[1-[4-(2,4-difluorophenyl)phenyl]sulfonylcyclopropyl]cyclohexan-1-ol.
| Compound Name | 4-[1-[4-(2,4-difluorophenyl)phenyl]sulfonylcyclopropyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 153404234 |
| Molecular Formula | C21H22F2O3S |
| Molecular Weight | 392.47 g/mol |
| Exact Mass | 392.13 |
| IUPAC Name | 4-[1-[4-(2,4-difluorophenyl)phenyl]sulfonylcyclopropyl]cyclohexan-1-ol |
| SMILES | O=S(=O)(c1ccc(-c2ccc(F)cc2F)cc1)C1(C2CCC(O)CC2)CC1 |
| InChI | InChI=1S/C21H22F2O3S/c22-16-5-10-19(20(23)13-16)14-1-8-18(9-2-14)27(25,26)21(11-12-21)15-3-6-17(24)7-4-15/h1-2,5,8-10,13,15,17,24H,3-4,6-7,11-12H2 |
| InChIKey | FWYVCSOTVWNOKY-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.47 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |