C23H40O3SSi — CID 10502467
tert-butyl-[(1S,3S)-3-(4-tert-butylphenyl)sulfonyl-3-methylcyclohexyl]oxy-dimethylsilane (PubChem CID 10502467) has the molecular formula C23H40O3SSi and a molecular weight of 424.72 g/mol. Its IUPAC name is tert-butyl-[(1S,3S)-3-(4-tert-butylphenyl)sulfonyl-3-methylcyclohexyl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(1S,3S)-3-(4-tert-butylphenyl)sulfonyl-3-methylcyclohexyl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 10502467 |
| Molecular Formula | C23H40O3SSi |
| Molecular Weight | 424.72 g/mol |
| Exact Mass | 424.25 |
| IUPAC Name | tert-butyl-[(1S,3S)-3-(4-tert-butylphenyl)sulfonyl-3-methylcyclohexyl]oxy-dimethylsilane |
| SMILES | CC(C)(C)c1ccc(S(=O)(=O)[C@@]2(C)CCC[C@H](O[Si](C)(C)C(C)(C)C)C2)cc1 |
| InChI | InChI=1S/C23H40O3SSi/c1-21(2,3)18-12-14-20(15-13-18)27(24,25)23(7)16-10-11-19(17-23)26-28(8,9)22(4,5)6/h12-15,19H,10-11,16-17H2,1-9H3/t19-,23-/m0/s1 |
| InChIKey | BKTPUQUZVLHYAW-CVDCTZTESA-N |
| XLogP | 6.48 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.72 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|