C23H32O3SSi — CID 91269358
tert-butyl-dimethyl-[3-(4-methylsulfonylphenyl)-2-phenylbut-3-enoxy]silane (PubChem CID 91269358) has the molecular formula C23H32O3SSi and a molecular weight of 416.66 g/mol. Its IUPAC name is tert-butyl-dimethyl-[3-(4-methylsulfonylphenyl)-2-phenylbut-3-enoxy]silane.
| Compound Name | tert-butyl-dimethyl-[3-(4-methylsulfonylphenyl)-2-phenylbut-3-enoxy]silane |
|---|---|
| PubChem CID | 91269358 |
| Molecular Formula | C23H32O3SSi |
| Molecular Weight | 416.66 g/mol |
| Exact Mass | 416.18 |
| IUPAC Name | tert-butyl-dimethyl-[3-(4-methylsulfonylphenyl)-2-phenylbut-3-enoxy]silane |
| SMILES | C=C(c1ccc(S(C)(=O)=O)cc1)C(CO[Si](C)(C)C(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C23H32O3SSi/c1-18(19-13-15-21(16-14-19)27(5,24)25)22(20-11-9-8-10-12-20)17-26-28(6,7)23(2,3)4/h8-16,22H,1,17H2,2-7H3 |
| InChIKey | POAMEAFPQQRGBB-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.66 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|