C17H15FO3S — CID 70095979
4-(3-fluorophenyl)-3-(4-methylsulfonylphenyl)-2,3-dihydrofuran (PubChem CID 70095979) has the molecular formula C17H15FO3S and a molecular weight of 318.37 g/mol. Its IUPAC name is 4-(3-fluorophenyl)-3-(4-methylsulfonylphenyl)-2,3-dihydrofuran.
| Compound Name | 4-(3-fluorophenyl)-3-(4-methylsulfonylphenyl)-2,3-dihydrofuran |
|---|---|
| PubChem CID | 70095979 |
| Molecular Formula | C17H15FO3S |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.07 |
| IUPAC Name | 4-(3-fluorophenyl)-3-(4-methylsulfonylphenyl)-2,3-dihydrofuran |
| SMILES | CS(=O)(=O)c1ccc(C2COC=C2c2cccc(F)c2)cc1 |
| InChI | InChI=1S/C17H15FO3S/c1-22(19,20)15-7-5-12(6-8-15)16-10-21-11-17(16)13-3-2-4-14(18)9-13/h2-9,11,16H,10H2,1H3 |
| InChIKey | ZXSZIPVBYOGDAK-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |