C20H32O3SSi — CID 10385148
[(1S,2S)-1-(benzenesulfonyl)-2-[(R)-cyclohexyl(methoxy)methyl]cyclopropyl]-trimethylsilane (PubChem CID 10385148) has the molecular formula C20H32O3SSi and a molecular weight of 380.63 g/mol. Its IUPAC name is [(1S,2S)-1-(benzenesulfonyl)-2-[(R)-cyclohexyl(methoxy)methyl]cyclopropyl]-trimethylsilane.
| Compound Name | [(1S,2S)-1-(benzenesulfonyl)-2-[(R)-cyclohexyl(methoxy)methyl]cyclopropyl]-trimethylsilane |
|---|---|
| PubChem CID | 10385148 |
| Molecular Formula | C20H32O3SSi |
| Molecular Weight | 380.63 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | [(1S,2S)-1-(benzenesulfonyl)-2-[(R)-cyclohexyl(methoxy)methyl]cyclopropyl]-trimethylsilane |
| SMILES | CO[C@H](C1CCCCC1)[C@@H]1C[C@]1([Si](C)(C)C)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C20H32O3SSi/c1-23-19(16-11-7-5-8-12-16)18-15-20(18,25(2,3)4)24(21,22)17-13-9-6-10-14-17/h6,9-10,13-14,16,18-19H,5,7-8,11-12,15H2,1-4H3/t18-,19+,20+/m0/s1 |
| InChIKey | NXTWOXHBNUAIHA-XUVXKRRUSA-N |
| XLogP | 4.69 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.63 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|