C25H42O3SSi — CID 10575571
tert-butyl-[(1S,3R)-3-(4-tert-butylphenyl)sulfonyl-3-prop-2-enylcyclohexyl]oxy-dimethylsilane (PubChem CID 10575571) has the molecular formula C25H42O3SSi and a molecular weight of 450.76 g/mol. Its IUPAC name is tert-butyl-[(1S,3R)-3-(4-tert-butylphenyl)sulfonyl-3-prop-2-enylcyclohexyl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(1S,3R)-3-(4-tert-butylphenyl)sulfonyl-3-prop-2-enylcyclohexyl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 10575571 |
| Molecular Formula | C25H42O3SSi |
| Molecular Weight | 450.76 g/mol |
| Exact Mass | 450.26 |
| IUPAC Name | tert-butyl-[(1S,3R)-3-(4-tert-butylphenyl)sulfonyl-3-prop-2-enylcyclohexyl]oxy-dimethylsilane |
| SMILES | C=CC[C@]1(S(=O)(=O)c2ccc(C(C)(C)C)cc2)CCC[C@H](O[Si](C)(C)C(C)(C)C)C1 |
| InChI | InChI=1S/C25H42O3SSi/c1-10-17-25(18-11-12-21(19-25)28-30(8,9)24(5,6)7)29(26,27)22-15-13-20(14-16-22)23(2,3)4/h10,13-16,21H,1,11-12,17-19H2,2-9H3/t21-,25-/m0/s1 |
| InChIKey | HTNDQQSABPMYRQ-OFVILXPXSA-N |
| XLogP | 7.04 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.76 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|