C22H34O3SSi — CID 134900615
[(3aS,4R,7aR)-7a-(benzenesulfonyl)-2-methylidene-3,3a,4,5,6,7-hexahydro-1H-inden-4-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 134900615) has the molecular formula C22H34O3SSi and a molecular weight of 406.66 g/mol. Its IUPAC name is [(3aS,4R,7aR)-7a-(benzenesulfonyl)-2-methylidene-3,3a,4,5,6,7-hexahydro-1H-inden-4-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(3aS,4R,7aR)-7a-(benzenesulfonyl)-2-methylidene-3,3a,4,5,6,7-hexahydro-1H-inden-4-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 134900615 |
| Molecular Formula | C22H34O3SSi |
| Molecular Weight | 406.66 g/mol |
| Exact Mass | 406.20 |
| IUPAC Name | [(3aS,4R,7aR)-7a-(benzenesulfonyl)-2-methylidene-3,3a,4,5,6,7-hexahydro-1H-inden-4-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | C=C1C[C@H]2[C@H](O[Si](C)(C)C(C)(C)C)CCC[C@@]2(S(=O)(=O)c2ccccc2)C1 |
| InChI | InChI=1S/C22H34O3SSi/c1-17-15-19-20(25-27(5,6)21(2,3)4)13-10-14-22(19,16-17)26(23,24)18-11-8-7-9-12-18/h7-9,11-12,19-20H,1,10,13-16H2,2-6H3/t19-,20+,22+/m0/s1 |
| InChIKey | ZFSVTKLIZRDZKM-TUNNFDKTSA-N |
| XLogP | 5.74 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.66 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|