C26H26O4S — CID 10410674
[(E)-4-(benzenesulfonyl)-1,6-diphenylhex-1-en-3-yl] acetate (PubChem CID 10410674) has the molecular formula C26H26O4S and a molecular weight of 434.56 g/mol. Its IUPAC name is [(E)-4-(benzenesulfonyl)-1,6-diphenylhex-1-en-3-yl] acetate.
| Compound Name | [(E)-4-(benzenesulfonyl)-1,6-diphenylhex-1-en-3-yl] acetate |
|---|---|
| PubChem CID | 10410674 |
| Molecular Formula | C26H26O4S |
| Molecular Weight | 434.56 g/mol |
| Exact Mass | 434.16 |
| IUPAC Name | [(E)-4-(benzenesulfonyl)-1,6-diphenylhex-1-en-3-yl] acetate |
| SMILES | CC(=O)OC(/C=C/c1ccccc1)C(CCc1ccccc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C26H26O4S/c1-21(27)30-25(19-17-22-11-5-2-6-12-22)26(20-18-23-13-7-3-8-14-23)31(28,29)24-15-9-4-10-16-24/h2-17,19,25-26H,18,20H2,1H3/b19-17+ |
| InChIKey | VEYZKGXHSSQLAN-HTXNQAPBSA-N |
| XLogP | 5.11 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.56 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |