C35H48O5SSi — CID 10746273
tert-butyl-[(4S)-7-(4-methylphenyl)sulfonyl-4-[(1S)-1-[(2R)-oxiran-2-yl]propoxy]heptoxy]-diphenylsilane (PubChem CID 10746273) has the molecular formula C35H48O5SSi and a molecular weight of 608.92 g/mol. Its IUPAC name is tert-butyl-[(4S)-7-(4-methylphenyl)sulfonyl-4-[(1S)-1-[(2R)-oxiran-2-yl]propoxy]heptoxy]-diphenylsilane.
| Compound Name | tert-butyl-[(4S)-7-(4-methylphenyl)sulfonyl-4-[(1S)-1-[(2R)-oxiran-2-yl]propoxy]heptoxy]-diphenylsilane |
|---|---|
| PubChem CID | 10746273 |
| Molecular Formula | C35H48O5SSi |
| Molecular Weight | 608.92 g/mol |
| Exact Mass | 608.30 |
| IUPAC Name | tert-butyl-[(4S)-7-(4-methylphenyl)sulfonyl-4-[(1S)-1-[(2R)-oxiran-2-yl]propoxy]heptoxy]-diphenylsilane |
| SMILES | CC[C@H](O[C@@H](CCCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)CCCS(=O)(=O)c1ccc(C)cc1)[C@H]1CO1 |
| InChI | InChI=1S/C35H48O5SSi/c1-6-33(34-27-38-34)40-29(16-14-26-41(36,37)30-23-21-28(2)22-24-30)15-13-25-39-42(35(3,4)5,31-17-9-7-10-18-31)32-19-11-8-12-20-32/h7-12,17-24,29,33-34H,6,13-16,25-27H2,1-5H3/t29-,33-,34+/m0/s1 |
| InChIKey | VTABYMSTPFNRSM-AENMGCNNSA-N |
| XLogP | 6.47 |
| TPSA | 65.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.92 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|