C32H40O3SSi — CID 10929516
(2S)-2-[(2R,4R,6S)-4-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-6-phenylsulfanyloxan-2-yl]propanal (PubChem CID 10929516) has the molecular formula C32H40O3SSi and a molecular weight of 532.82 g/mol. Its IUPAC name is (2S)-2-[(2R,4R,6S)-4-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-6-phenylsulfanyloxan-2-yl]propanal.
| Compound Name | (2S)-2-[(2R,4R,6S)-4-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-6-phenylsulfanyloxan-2-yl]propanal |
|---|---|
| PubChem CID | 10929516 |
| Molecular Formula | C32H40O3SSi |
| Molecular Weight | 532.82 g/mol |
| Exact Mass | 532.25 |
| IUPAC Name | (2S)-2-[(2R,4R,6S)-4-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-6-phenylsulfanyloxan-2-yl]propanal |
| SMILES | CC(C=O)[C@H]1C[C@@H](CCO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)C[C@H](Sc2ccccc2)O1 |
| InChI | InChI=1S/C32H40O3SSi/c1-25(24-33)30-22-26(23-31(35-30)36-27-14-8-5-9-15-27)20-21-34-37(32(2,3)4,28-16-10-6-11-17-28)29-18-12-7-13-19-29/h5-19,24-26,30-31H,20-23H2,1-4H3/t25?,26-,30-,31+/m1/s1 |
| InChIKey | DQHQGCMXRQUHEC-ULBBHERRSA-N |
| XLogP | 6.70 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.82 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|