C21H34O3SSi — CID 10916241
2-[(2R,3R,4R,5S,6S)-4-[tert-butyl(dimethyl)silyl]oxy-3,5-dimethyl-6-phenylsulfanyloxan-2-yl]acetaldehyde (PubChem CID 10916241) has the molecular formula C21H34O3SSi and a molecular weight of 394.65 g/mol. Its IUPAC name is 2-[(2R,3R,4R,5S,6S)-4-[tert-butyl(dimethyl)silyl]oxy-3,5-dimethyl-6-phenylsulfanyloxan-2-yl]acetaldehyde.
| Compound Name | 2-[(2R,3R,4R,5S,6S)-4-[tert-butyl(dimethyl)silyl]oxy-3,5-dimethyl-6-phenylsulfanyloxan-2-yl]acetaldehyde |
|---|---|
| PubChem CID | 10916241 |
| Molecular Formula | C21H34O3SSi |
| Molecular Weight | 394.65 g/mol |
| Exact Mass | 394.20 |
| IUPAC Name | 2-[(2R,3R,4R,5S,6S)-4-[tert-butyl(dimethyl)silyl]oxy-3,5-dimethyl-6-phenylsulfanyloxan-2-yl]acetaldehyde |
| SMILES | C[C@H]1[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](C)[C@H](Sc2ccccc2)O[C@@H]1CC=O |
| InChI | InChI=1S/C21H34O3SSi/c1-15-18(13-14-22)23-20(25-17-11-9-8-10-12-17)16(2)19(15)24-26(6,7)21(3,4)5/h8-12,14-16,18-20H,13H2,1-7H3/t15-,16+,18-,19-,20+/m1/s1 |
| InChIKey | WPESLRACISAZPP-LHDHZVESSA-N |
| XLogP | 5.76 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.65 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|