C15H20O3S — CID 18729290
4-methoxy-2,5-dimethyl-6-phenylsulfanyloxane-3-carbaldehyde (PubChem CID 18729290) has the molecular formula C15H20O3S and a molecular weight of 280.39 g/mol. Its IUPAC name is 4-methoxy-2,5-dimethyl-6-phenylsulfanyloxane-3-carbaldehyde.
| Compound Name | 4-methoxy-2,5-dimethyl-6-phenylsulfanyloxane-3-carbaldehyde |
|---|---|
| PubChem CID | 18729290 |
| Molecular Formula | C15H20O3S |
| Molecular Weight | 280.39 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | 4-methoxy-2,5-dimethyl-6-phenylsulfanyloxane-3-carbaldehyde |
| SMILES | COC1C(C)C(Sc2ccccc2)OC(C)C1C=O |
| InChI | InChI=1S/C15H20O3S/c1-10-14(17-3)13(9-16)11(2)18-15(10)19-12-7-5-4-6-8-12/h4-11,13-15H,1-3H3 |
| InChIKey | BAPNSWGUBODNQS-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.39 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|