C16H24O3S — CID 15811974
4,6-dimethoxy-7-(4-methylphenyl)sulfanylheptan-2-one (PubChem CID 15811974) has the molecular formula C16H24O3S and a molecular weight of 296.43 g/mol. Its IUPAC name is 4,6-dimethoxy-7-(4-methylphenyl)sulfanylheptan-2-one.
| Compound Name | 4,6-dimethoxy-7-(4-methylphenyl)sulfanylheptan-2-one |
|---|---|
| PubChem CID | 15811974 |
| Molecular Formula | C16H24O3S |
| Molecular Weight | 296.43 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | 4,6-dimethoxy-7-(4-methylphenyl)sulfanylheptan-2-one |
| SMILES | COC(CSc1ccc(C)cc1)CC(CC(C)=O)OC |
| InChI | InChI=1S/C16H24O3S/c1-12-5-7-16(8-6-12)20-11-15(19-4)10-14(18-3)9-13(2)17/h5-8,14-15H,9-11H2,1-4H3 |
| InChIKey | VHNGFQSSFQBZOL-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.43 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |