C37H46O3SSi — CID 11135752
(2E,4E,6R)-6-[(2R,4R,6S)-4-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-6-phenylsulfanyloxan-2-yl]-2-methylhepta-2,4-dienal (PubChem CID 11135752) has the molecular formula C37H46O3SSi and a molecular weight of 598.93 g/mol. Its IUPAC name is (2E,4E,6R)-6-[(2R,4R,6S)-4-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-6-phenylsulfanyloxan-2-yl]-2-methylhepta-2,4-dienal.
| Compound Name | (2E,4E,6R)-6-[(2R,4R,6S)-4-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-6-phenylsulfanyloxan-2-yl]-2-methylhepta-2,4-dienal |
|---|---|
| PubChem CID | 11135752 |
| Molecular Formula | C37H46O3SSi |
| Molecular Weight | 598.93 g/mol |
| Exact Mass | 598.29 |
| IUPAC Name | (2E,4E,6R)-6-[(2R,4R,6S)-4-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-6-phenylsulfanyloxan-2-yl]-2-methylhepta-2,4-dienal |
| SMILES | C/C(C=O)=C\C=C\[C@@H](C)[C@H]1C[C@@H](CCO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)C[C@H](Sc2ccccc2)O1 |
| InChI | InChI=1S/C37H46O3SSi/c1-29(28-38)16-15-17-30(2)35-26-31(27-36(40-35)41-32-18-9-6-10-19-32)24-25-39-42(37(3,4)5,33-20-11-7-12-21-33)34-22-13-8-14-23-34/h6-23,28,30-31,35-36H,24-27H2,1-5H3/b17-15+,29-16+/t30-,31-,35-,36+/m1/s1 |
| InChIKey | WFPLSYYQBWNOEN-OJBPCARDSA-N |
| XLogP | 8.20 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.93 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|