C38H48O4SSi — CID 10875908
methyl (2E,4E,6R)-6-[(2R,4R,6S)-4-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-6-phenylsulfanyloxan-2-yl]-2-methylhepta-2,4-dienoate (PubChem CID 10875908) has the molecular formula C38H48O4SSi and a molecular weight of 628.95 g/mol. Its IUPAC name is methyl (2E,4E,6R)-6-[(2R,4R,6S)-4-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-6-phenylsulfanyloxan-2-yl]-2-methylhepta-2,4-dienoate.
| Compound Name | methyl (2E,4E,6R)-6-[(2R,4R,6S)-4-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-6-phenylsulfanyloxan-2-yl]-2-methylhepta-2,4-dienoate |
|---|---|
| PubChem CID | 10875908 |
| Molecular Formula | C38H48O4SSi |
| Molecular Weight | 628.95 g/mol |
| Exact Mass | 628.30 |
| IUPAC Name | methyl (2E,4E,6R)-6-[(2R,4R,6S)-4-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-6-phenylsulfanyloxan-2-yl]-2-methylhepta-2,4-dienoate |
| SMILES | COC(=O)/C(C)=C/C=C/[C@@H](C)[C@H]1C[C@@H](CCO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)C[C@H](Sc2ccccc2)O1 |
| InChI | InChI=1S/C38H48O4SSi/c1-29(17-16-18-30(2)37(39)40-6)35-27-31(28-36(42-35)43-32-19-10-7-11-20-32)25-26-41-44(38(3,4)5,33-21-12-8-13-22-33)34-23-14-9-15-24-34/h7-24,29,31,35-36H,25-28H2,1-6H3/b17-16+,30-18+/t29-,31-,35-,36+/m1/s1 |
| InChIKey | IZEFGVGRDSQEFI-IZCAKZQRSA-N |
| XLogP | 8.18 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.95 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|