C34H42O6S — CID 11050122
ethyl (E,5S,7R,8S)-9-(benzenesulfonyl)-8-methyl-7-phenylmethoxy-5-(2-phenylmethoxyethyl)non-2-enoate (PubChem CID 11050122) has the molecular formula C34H42O6S and a molecular weight of 578.77 g/mol. Its IUPAC name is ethyl (E,5S,7R,8S)-9-(benzenesulfonyl)-8-methyl-7-phenylmethoxy-5-(2-phenylmethoxyethyl)non-2-enoate.
| Compound Name | ethyl (E,5S,7R,8S)-9-(benzenesulfonyl)-8-methyl-7-phenylmethoxy-5-(2-phenylmethoxyethyl)non-2-enoate |
|---|---|
| PubChem CID | 11050122 |
| Molecular Formula | C34H42O6S |
| Molecular Weight | 578.77 g/mol |
| Exact Mass | 578.27 |
| IUPAC Name | ethyl (E,5S,7R,8S)-9-(benzenesulfonyl)-8-methyl-7-phenylmethoxy-5-(2-phenylmethoxyethyl)non-2-enoate |
| SMILES | CCOC(=O)/C=C/C[C@@H](CCOCc1ccccc1)C[C@@H](OCc1ccccc1)[C@H](C)CS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C34H42O6S/c1-3-39-34(35)21-13-18-29(22-23-38-25-30-14-7-4-8-15-30)24-33(40-26-31-16-9-5-10-17-31)28(2)27-41(36,37)32-19-11-6-12-20-32/h4-17,19-21,28-29,33H,3,18,22-27H2,1-2H3/b21-13+/t28-,29+,33-/m1/s1 |
| InChIKey | FWNCGGRUPZDQLE-BOXPDUPXSA-N |
| XLogP | 6.80 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.77 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|