C25H32O5S — CID 11362788
benzyl (2S)-6-[(2S,3S,5S)-5-(benzenesulfonyl)-3-methyloxolan-2-yl]-2-methylhexanoate (PubChem CID 11362788) has the molecular formula C25H32O5S and a molecular weight of 444.59 g/mol. Its IUPAC name is benzyl (2S)-6-[(2S,3S,5S)-5-(benzenesulfonyl)-3-methyloxolan-2-yl]-2-methylhexanoate.
| Compound Name | benzyl (2S)-6-[(2S,3S,5S)-5-(benzenesulfonyl)-3-methyloxolan-2-yl]-2-methylhexanoate |
|---|---|
| PubChem CID | 11362788 |
| Molecular Formula | C25H32O5S |
| Molecular Weight | 444.59 g/mol |
| Exact Mass | 444.20 |
| IUPAC Name | benzyl (2S)-6-[(2S,3S,5S)-5-(benzenesulfonyl)-3-methyloxolan-2-yl]-2-methylhexanoate |
| SMILES | C[C@@H](CCCC[C@@H]1O[C@@H](S(=O)(=O)c2ccccc2)C[C@@H]1C)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C25H32O5S/c1-19(25(26)29-18-21-12-5-3-6-13-21)11-9-10-16-23-20(2)17-24(30-23)31(27,28)22-14-7-4-8-15-22/h3-8,12-15,19-20,23-24H,9-11,16-18H2,1-2H3/t19-,20-,23-,24-/m0/s1 |
| InChIKey | PAQDARUYPQDBMD-TZYAJKAJSA-N |
| XLogP | 5.15 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.59 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|