C26H25FO4S — CID 163359661
[(E)-7-(benzenesulfonyl)-1-(4-fluorophenyl)hept-5-en-3-yl] benzoate (PubChem CID 163359661) has the molecular formula C26H25FO4S and a molecular weight of 452.55 g/mol. Its IUPAC name is [(E)-7-(benzenesulfonyl)-1-(4-fluorophenyl)hept-5-en-3-yl] benzoate.
| Compound Name | [(E)-7-(benzenesulfonyl)-1-(4-fluorophenyl)hept-5-en-3-yl] benzoate |
|---|---|
| PubChem CID | 163359661 |
| Molecular Formula | C26H25FO4S |
| Molecular Weight | 452.55 g/mol |
| Exact Mass | 452.15 |
| IUPAC Name | [(E)-7-(benzenesulfonyl)-1-(4-fluorophenyl)hept-5-en-3-yl] benzoate |
| SMILES | O=C(OC(C/C=C/CS(=O)(=O)c1ccccc1)CCc1ccc(F)cc1)c1ccccc1 |
| InChI | InChI=1S/C26H25FO4S/c27-23-17-14-21(15-18-23)16-19-24(31-26(28)22-9-3-1-4-10-22)11-7-8-20-32(29,30)25-12-5-2-6-13-25/h1-10,12-15,17-18,24H,11,16,19-20H2/b8-7+ |
| InChIKey | QKVHMPLVUVIKJG-BQYQJAHWSA-N |
| XLogP | 5.40 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.55 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|