C44H48O6SSi — CID 135078323
[2-[[tert-butyl(diphenyl)silyl]oxymethyl]-4,5-bis(phenylmethoxy)-6-phenylsulfanyloxan-3-yl] acetate (PubChem CID 135078323) has the molecular formula C44H48O6SSi and a molecular weight of 733.02 g/mol. Its IUPAC name is [2-[[tert-butyl(diphenyl)silyl]oxymethyl]-4,5-bis(phenylmethoxy)-6-phenylsulfanyloxan-3-yl] acetate.
| Compound Name | [2-[[tert-butyl(diphenyl)silyl]oxymethyl]-4,5-bis(phenylmethoxy)-6-phenylsulfanyloxan-3-yl] acetate |
|---|---|
| PubChem CID | 135078323 |
| Molecular Formula | C44H48O6SSi |
| Molecular Weight | 733.02 g/mol |
| Exact Mass | 732.29 |
| IUPAC Name | [2-[[tert-butyl(diphenyl)silyl]oxymethyl]-4,5-bis(phenylmethoxy)-6-phenylsulfanyloxan-3-yl] acetate |
| SMILES | CC(=O)OC1C(CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)OC(Sc2ccccc2)C(OCc2ccccc2)C1OCc1ccccc1 |
| InChI | InChI=1S/C44H48O6SSi/c1-33(45)49-40-39(32-48-52(44(2,3)4,37-26-16-8-17-27-37)38-28-18-9-19-29-38)50-43(51-36-24-14-7-15-25-36)42(47-31-35-22-12-6-13-23-35)41(40)46-30-34-20-10-5-11-21-34/h5-29,39-43H,30-32H2,1-4H3 |
| InChIKey | OEMQQNDZIHHMOD-UHFFFAOYSA-N |
| XLogP | 8.18 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 733.02 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|