C44H48O6SSi — CID 10818737
[(2R,3R,4S,5S,6R)-4-[tert-butyl(diphenyl)silyl]oxy-3,5-bis(phenylmethoxy)-6-phenylsulfanyloxan-2-yl]methyl acetate (PubChem CID 10818737) has the molecular formula C44H48O6SSi and a molecular weight of 733.02 g/mol. Its IUPAC name is [(2R,3R,4S,5S,6R)-4-[tert-butyl(diphenyl)silyl]oxy-3,5-bis(phenylmethoxy)-6-phenylsulfanyloxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5S,6R)-4-[tert-butyl(diphenyl)silyl]oxy-3,5-bis(phenylmethoxy)-6-phenylsulfanyloxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 10818737 |
| Molecular Formula | C44H48O6SSi |
| Molecular Weight | 733.02 g/mol |
| Exact Mass | 732.29 |
| IUPAC Name | [(2R,3R,4S,5S,6R)-4-[tert-butyl(diphenyl)silyl]oxy-3,5-bis(phenylmethoxy)-6-phenylsulfanyloxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@H](Sc2ccccc2)[C@@H](OCc2ccccc2)[C@@H](O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C44H48O6SSi/c1-33(45)46-32-39-40(47-30-34-20-10-5-11-21-34)41(50-52(44(2,3)4,37-26-16-8-17-27-37)38-28-18-9-19-29-38)42(48-31-35-22-12-6-13-23-35)43(49-39)51-36-24-14-7-15-25-36/h5-29,39-43H,30-32H2,1-4H3/t39-,40-,41+,42+,43-/m1/s1 |
| InChIKey | DPHGRFRUKWKRAB-UMCCLHMTSA-N |
| XLogP | 8.18 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 733.02 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|