C32H38O5SSi — CID 14928536
methyl (E,4R)-6-[tert-butyl(diphenyl)silyl]oxy-4-[(2R)-2-phenylsulfanylpropanoyl]oxyhex-2-enoate (PubChem CID 14928536) has the molecular formula C32H38O5SSi and a molecular weight of 562.80 g/mol. Its IUPAC name is methyl (E,4R)-6-[tert-butyl(diphenyl)silyl]oxy-4-[(2R)-2-phenylsulfanylpropanoyl]oxyhex-2-enoate.
| Compound Name | methyl (E,4R)-6-[tert-butyl(diphenyl)silyl]oxy-4-[(2R)-2-phenylsulfanylpropanoyl]oxyhex-2-enoate |
|---|---|
| PubChem CID | 14928536 |
| Molecular Formula | C32H38O5SSi |
| Molecular Weight | 562.80 g/mol |
| Exact Mass | 562.22 |
| IUPAC Name | methyl (E,4R)-6-[tert-butyl(diphenyl)silyl]oxy-4-[(2R)-2-phenylsulfanylpropanoyl]oxyhex-2-enoate |
| SMILES | COC(=O)/C=C/[C@@H](CCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)OC(=O)[C@@H](C)Sc1ccccc1 |
| InChI | InChI=1S/C32H38O5SSi/c1-25(38-27-15-9-6-10-16-27)31(34)37-26(21-22-30(33)35-5)23-24-36-39(32(2,3)4,28-17-11-7-12-18-28)29-19-13-8-14-20-29/h6-22,25-26H,23-24H2,1-5H3/b22-21+/t25-,26+/m1/s1 |
| InChIKey | COHOLNZLOLEAMO-LANXJXPGSA-N |
| XLogP | 5.77 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.80 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|