C27H32O3SSi — CID 143324165
3-[dimethyl(triphenylsilyloxy)-λ4-sulfanyl]propyl 2-methylprop-2-enoate (PubChem CID 143324165) has the molecular formula C27H32O3SSi and a molecular weight of 464.70 g/mol. Its IUPAC name is 3-[dimethyl(triphenylsilyloxy)-λ4-sulfanyl]propyl 2-methylprop-2-enoate.
| Compound Name | 3-[dimethyl(triphenylsilyloxy)-λ4-sulfanyl]propyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 143324165 |
| Molecular Formula | C27H32O3SSi |
| Molecular Weight | 464.70 g/mol |
| Exact Mass | 464.18 |
| IUPAC Name | 3-[dimethyl(triphenylsilyloxy)-λ4-sulfanyl]propyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCS(C)(C)O[Si](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H32O3SSi/c1-23(2)27(28)29-21-14-22-31(3,4)30-32(24-15-8-5-9-16-24,25-17-10-6-11-18-25)26-19-12-7-13-20-26/h5-13,15-20H,1,14,21-22H2,2-4H3 |
| InChIKey | HFGABBDRDLMUTR-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.70 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|