C29H40O3S2Si — CID 134875375
methyl (2E,4Z,6R)-6-[tert-butyl(diphenyl)silyl]oxy-8,8-bis(ethylsulfanyl)octa-2,4-dienoate (PubChem CID 134875375) has the molecular formula C29H40O3S2Si and a molecular weight of 528.86 g/mol. Its IUPAC name is methyl (2E,4Z,6R)-6-[tert-butyl(diphenyl)silyl]oxy-8,8-bis(ethylsulfanyl)octa-2,4-dienoate.
| Compound Name | methyl (2E,4Z,6R)-6-[tert-butyl(diphenyl)silyl]oxy-8,8-bis(ethylsulfanyl)octa-2,4-dienoate |
|---|---|
| PubChem CID | 134875375 |
| Molecular Formula | C29H40O3S2Si |
| Molecular Weight | 528.86 g/mol |
| Exact Mass | 528.22 |
| IUPAC Name | methyl (2E,4Z,6R)-6-[tert-butyl(diphenyl)silyl]oxy-8,8-bis(ethylsulfanyl)octa-2,4-dienoate |
| SMILES | CCSC(C[C@H](/C=C\C=C\C(=O)OC)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)SCC |
| InChI | InChI=1S/C29H40O3S2Si/c1-7-33-28(34-8-2)23-24(17-15-16-22-27(30)31-6)32-35(29(3,4)5,25-18-11-9-12-19-25)26-20-13-10-14-21-26/h9-22,24,28H,7-8,23H2,1-6H3/b17-15-,22-16+/t24-/m0/s1 |
| InChIKey | ZUGFOQRACJUDIZ-MGBBHTGOSA-N |
| XLogP | 6.44 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.86 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|