About 4-phenylsulfanylbutyl 2-methyl-8-phenylsulfanyloct-2-enoate
4-phenylsulfanylbutyl 2-methyl-8-phenylsulfanyloct-2-enoate (PubChem CID 57279199) has the molecular formula C25H32O2S2
and a molecular weight of 428.66 g/mol. Its IUPAC name is 4-phenylsulfanylbutyl 2-methyl-8-phenylsulfanyloct-2-enoate.
Molecular Properties
| Compound Name | 4-phenylsulfanylbutyl 2-methyl-8-phenylsulfanyloct-2-enoate |
| PubChem CID | 57279199 |
| Molecular Formula | C25H32O2S2 |
| Molecular Weight | 428.66 g/mol |
| Exact Mass | 428.18 |
| IUPAC Name | 4-phenylsulfanylbutyl 2-methyl-8-phenylsulfanyloct-2-enoate |
| SMILES | CC(=CCCCCCSc1ccccc1)C(=O)OCCCCSc1ccccc1 |
| InChI | InChI=1S/C25H32O2S2/c1-22(14-6-2-3-12-20-28-23-15-7-4-8-16-23)25(26)27-19-11-13-21-29-24-17-9-5-10-18-24/h4-5,7-10,14-18H,2-3,6,11-13,19-21H2,1H3 |
| InChIKey | ODPPPZZNXORASD-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 428.66 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 4-phenylsulfanylbutyl 2-methyl-8-phenylsulfanyloct-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-phenylsulfanylbutyl 2-methyl-8-phenylsulfanyloct-2-enoate?
The IUPAC name of 4-phenylsulfanylbutyl 2-methyl-8-phenylsulfanyloct-2-enoate (CID 57279199) is 4-phenylsulfanylbutyl 2-methyl-8-phenylsulfanyloct-2-enoate.
What is the SMILES notation for 4-phenylsulfanylbutyl 2-methyl-8-phenylsulfanyloct-2-enoate?
The canonical SMILES for 4-phenylsulfanylbutyl 2-methyl-8-phenylsulfanyloct-2-enoate is CC(=CCCCCCSc1ccccc1)C(=O)OCCCCSc1ccccc1.
What is the InChIKey of 4-phenylsulfanylbutyl 2-methyl-8-phenylsulfanyloct-2-enoate?
The InChIKey is ODPPPZZNXORASD-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H32O2S2/c1-22(14-6-2-3-12-20-28-23-15-7-4-8-16-23)25(26)27-19-11-13-21-29-24-17-9-5-10-18-24/h4-5,7-10,14-18H,2-3,6,11-13,19-21H2,1H3.
What are the key properties of 4-phenylsulfanylbutyl 2-methyl-8-phenylsulfanyloct-2-enoate?
4-phenylsulfanylbutyl 2-methyl-8-phenylsulfanyloct-2-enoate has a molecular weight of 428.66 g/mol, XLogP of 7.40, 14 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-phenylsulfanylbutyl 2-methyl-8-phenylsulfanyloct-2-enoate is sourced from PubChem (CID 57279199), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).