C18H24O4S — CID 10337098
ethyl (E,4R)-2-methyl-4-(2-phenylsulfanylacetyl)oxyhept-2-enoate (PubChem CID 10337098) has the molecular formula C18H24O4S and a molecular weight of 336.45 g/mol. Its IUPAC name is ethyl (E,4R)-2-methyl-4-(2-phenylsulfanylacetyl)oxyhept-2-enoate.
| Compound Name | ethyl (E,4R)-2-methyl-4-(2-phenylsulfanylacetyl)oxyhept-2-enoate |
|---|---|
| PubChem CID | 10337098 |
| Molecular Formula | C18H24O4S |
| Molecular Weight | 336.45 g/mol |
| Exact Mass | 336.14 |
| IUPAC Name | ethyl (E,4R)-2-methyl-4-(2-phenylsulfanylacetyl)oxyhept-2-enoate |
| SMILES | CCC[C@H](/C=C(\C)C(=O)OCC)OC(=O)CSc1ccccc1 |
| InChI | InChI=1S/C18H24O4S/c1-4-9-15(12-14(3)18(20)21-5-2)22-17(19)13-23-16-10-7-6-8-11-16/h6-8,10-12,15H,4-5,9,13H2,1-3H3/b14-12+/t15-/m1/s1 |
| InChIKey | QBUUGGSCLAAQLE-OKFGHLOFSA-N |
| XLogP | 4.00 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.45 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|