C41H56O6SSi — CID 10794865
trans-tert-butyl (1R,3R)-3-[(E)-2-(benzenesulfonyl)-7-[tert-butyl(diphenyl)silyl]oxy-1-hydroxy-3-methyloct-3-enyl]-2,2-dimethylcyclopropane-1-carboxylate (PubChem CID 10794865) has the molecular formula C41H56O6SSi and a molecular weight of 705.05 g/mol. Its IUPAC name is trans-tert-butyl (1R,3R)-3-[(E)-2-(benzenesulfonyl)-7-[tert-butyl(diphenyl)silyl]oxy-1-hydroxy-3-methyloct-3-enyl]-2,2-dimethylcyclopropane-1-carboxylate.
| Compound Name | trans-tert-butyl (1R,3R)-3-[(E)-2-(benzenesulfonyl)-7-[tert-butyl(diphenyl)silyl]oxy-1-hydroxy-3-methyloct-3-enyl]-2,2-dimethylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 10794865 |
| Molecular Formula | C41H56O6SSi |
| Molecular Weight | 705.05 g/mol |
| Exact Mass | 704.36 |
| IUPAC Name | trans-tert-butyl (1R,3R)-3-[(E)-2-(benzenesulfonyl)-7-[tert-butyl(diphenyl)silyl]oxy-1-hydroxy-3-methyloct-3-enyl]-2,2-dimethylcyclopropane-1-carboxylate |
| SMILES | C/C(=C\CCC(C)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)C(C(O)[C@@H]1[C@@H](C(=O)OC(C)(C)C)C1(C)C)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C41H56O6SSi/c1-29(21-20-22-30(2)47-49(40(6,7)8,32-25-16-12-17-26-32)33-27-18-13-19-28-33)37(48(44,45)31-23-14-11-15-24-31)36(42)34-35(41(34,9)10)38(43)46-39(3,4)5/h11-19,21,23-28,30,34-37,42H,20,22H2,1-10H3/b29-21+/t30?,34-,35-,36?,37?/m0/s1 |
| InChIKey | WLHOYAUUOXQIJN-XVJFCGPSSA-N |
| XLogP | 7.50 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.05 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|