C32H55FO5SSi2 — CID 10326631
ethyl 2-(benzenesulfinyl)-2-[(3R,4R,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-4-(3-fluoropropyl)-2-methylidenecyclohexyl]acetate (PubChem CID 10326631) has the molecular formula C32H55FO5SSi2 and a molecular weight of 627.02 g/mol. Its IUPAC name is ethyl 2-(benzenesulfinyl)-2-[(3R,4R,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-4-(3-fluoropropyl)-2-methylidenecyclohexyl]acetate.
| Compound Name | ethyl 2-(benzenesulfinyl)-2-[(3R,4R,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-4-(3-fluoropropyl)-2-methylidenecyclohexyl]acetate |
|---|---|
| PubChem CID | 10326631 |
| Molecular Formula | C32H55FO5SSi2 |
| Molecular Weight | 627.02 g/mol |
| Exact Mass | 626.33 |
| IUPAC Name | ethyl 2-(benzenesulfinyl)-2-[(3R,4R,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-4-(3-fluoropropyl)-2-methylidenecyclohexyl]acetate |
| SMILES | C=C1C(C(C(=O)OCC)S(=O)c2ccccc2)C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](CCCF)[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C32H55FO5SSi2/c1-13-36-30(34)29(39(35)24-18-15-14-16-19-24)26-22-27(37-40(9,10)31(3,4)5)25(20-17-21-33)28(23(26)2)38-41(11,12)32(6,7)8/h14-16,18-19,25-29H,2,13,17,20-22H2,1,3-12H3/t25-,26?,27-,28+,29?,39?/m1/s1 |
| InChIKey | XNTFCSPDHRMXQU-HOJRQFOTSA-N |
| XLogP | 8.45 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.02 |
| LogP ≤ 5 | 8.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|