C22H32O5SSi — CID 10906243
(3aR,6S,7aR)-3-(benzenesulfinylmethyl)-6-methyl-6-triethylsilyloxy-3a,4,7,7a-tetrahydro-3H-1-benzofuran-2,5-dione (PubChem CID 10906243) has the molecular formula C22H32O5SSi and a molecular weight of 436.65 g/mol. Its IUPAC name is (3aR,6S,7aR)-3-(benzenesulfinylmethyl)-6-methyl-6-triethylsilyloxy-3a,4,7,7a-tetrahydro-3H-1-benzofuran-2,5-dione.
| Compound Name | (3aR,6S,7aR)-3-(benzenesulfinylmethyl)-6-methyl-6-triethylsilyloxy-3a,4,7,7a-tetrahydro-3H-1-benzofuran-2,5-dione |
|---|---|
| PubChem CID | 10906243 |
| Molecular Formula | C22H32O5SSi |
| Molecular Weight | 436.65 g/mol |
| Exact Mass | 436.17 |
| IUPAC Name | (3aR,6S,7aR)-3-(benzenesulfinylmethyl)-6-methyl-6-triethylsilyloxy-3a,4,7,7a-tetrahydro-3H-1-benzofuran-2,5-dione |
| SMILES | CC[Si](CC)(CC)O[C@@]1(C)C[C@H]2OC(=O)C(CS(=O)c3ccccc3)[C@H]2CC1=O |
| InChI | InChI=1S/C22H32O5SSi/c1-5-29(6-2,7-3)27-22(4)14-19-17(13-20(22)23)18(21(24)26-19)15-28(25)16-11-9-8-10-12-16/h8-12,17-19H,5-7,13-15H2,1-4H3/t17-,18?,19-,22+,28?/m1/s1 |
| InChIKey | BJDHKACEWHVKCX-BSJDJMAESA-N |
| XLogP | 4.10 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.65 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|