C16H18O4S — CID 101104996
(3R,3aR,6S,7aR)-6-hydroxy-6-methyl-3-(phenylsulfanylmethyl)-3a,4,7,7a-tetrahydro-3H-1-benzofuran-2,5-dione (PubChem CID 101104996) has the molecular formula C16H18O4S and a molecular weight of 306.38 g/mol. Its IUPAC name is (3R,3aR,6S,7aR)-6-hydroxy-6-methyl-3-(phenylsulfanylmethyl)-3a,4,7,7a-tetrahydro-3H-1-benzofuran-2,5-dione.
| Compound Name | (3R,3aR,6S,7aR)-6-hydroxy-6-methyl-3-(phenylsulfanylmethyl)-3a,4,7,7a-tetrahydro-3H-1-benzofuran-2,5-dione |
|---|---|
| PubChem CID | 101104996 |
| Molecular Formula | C16H18O4S |
| Molecular Weight | 306.38 g/mol |
| Exact Mass | 306.09 |
| IUPAC Name | (3R,3aR,6S,7aR)-6-hydroxy-6-methyl-3-(phenylsulfanylmethyl)-3a,4,7,7a-tetrahydro-3H-1-benzofuran-2,5-dione |
| SMILES | C[C@]1(O)C[C@H]2OC(=O)[C@H](CSc3ccccc3)[C@H]2CC1=O |
| InChI | InChI=1S/C16H18O4S/c1-16(19)8-13-11(7-14(16)17)12(15(18)20-13)9-21-10-5-3-2-4-6-10/h2-6,11-13,19H,7-9H2,1H3/t11-,12-,13-,16+/m1/s1 |
| InChIKey | DJDZFSVZUPGQSI-JXFSHQFZSA-N |
| XLogP | 2.05 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.38 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |