C20H20O4S — CID 11013721
(3R,3aR,6S,7aR)-6-hydroxy-6-methyl-3-(naphthalen-2-ylsulfanylmethyl)-3a,4,7,7a-tetrahydro-3H-1-benzofuran-2,5-dione (PubChem CID 11013721) has the molecular formula C20H20O4S and a molecular weight of 356.44 g/mol. Its IUPAC name is (3R,3aR,6S,7aR)-6-hydroxy-6-methyl-3-(naphthalen-2-ylsulfanylmethyl)-3a,4,7,7a-tetrahydro-3H-1-benzofuran-2,5-dione.
| Compound Name | (3R,3aR,6S,7aR)-6-hydroxy-6-methyl-3-(naphthalen-2-ylsulfanylmethyl)-3a,4,7,7a-tetrahydro-3H-1-benzofuran-2,5-dione |
|---|---|
| PubChem CID | 11013721 |
| Molecular Formula | C20H20O4S |
| Molecular Weight | 356.44 g/mol |
| Exact Mass | 356.11 |
| IUPAC Name | (3R,3aR,6S,7aR)-6-hydroxy-6-methyl-3-(naphthalen-2-ylsulfanylmethyl)-3a,4,7,7a-tetrahydro-3H-1-benzofuran-2,5-dione |
| SMILES | C[C@]1(O)C[C@H]2OC(=O)[C@H](CSc3ccc4ccccc4c3)[C@H]2CC1=O |
| InChI | InChI=1S/C20H20O4S/c1-20(23)10-17-15(9-18(20)21)16(19(22)24-17)11-25-14-7-6-12-4-2-3-5-13(12)8-14/h2-8,15-17,23H,9-11H2,1H3/t15-,16-,17-,20+/m1/s1 |
| InChIKey | WKCNRVOVTIKWDG-VIPLHTEESA-N |
| XLogP | 3.20 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.44 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |