C17H20O4S — CID 11088500
(3R,3aR,6S,7aR)-6-hydroxy-6-methyl-3-[(4-methylphenyl)sulfanylmethyl]-3a,4,7,7a-tetrahydro-3H-1-benzofuran-2,5-dione (PubChem CID 11088500) has the molecular formula C17H20O4S and a molecular weight of 320.41 g/mol. Its IUPAC name is (3R,3aR,6S,7aR)-6-hydroxy-6-methyl-3-[(4-methylphenyl)sulfanylmethyl]-3a,4,7,7a-tetrahydro-3H-1-benzofuran-2,5-dione.
| Compound Name | (3R,3aR,6S,7aR)-6-hydroxy-6-methyl-3-[(4-methylphenyl)sulfanylmethyl]-3a,4,7,7a-tetrahydro-3H-1-benzofuran-2,5-dione |
|---|---|
| PubChem CID | 11088500 |
| Molecular Formula | C17H20O4S |
| Molecular Weight | 320.41 g/mol |
| Exact Mass | 320.11 |
| IUPAC Name | (3R,3aR,6S,7aR)-6-hydroxy-6-methyl-3-[(4-methylphenyl)sulfanylmethyl]-3a,4,7,7a-tetrahydro-3H-1-benzofuran-2,5-dione |
| SMILES | Cc1ccc(SC[C@H]2C(=O)O[C@@H]3C[C@](C)(O)C(=O)C[C@@H]32)cc1 |
| InChI | InChI=1S/C17H20O4S/c1-10-3-5-11(6-4-10)22-9-13-12-7-15(18)17(2,20)8-14(12)21-16(13)19/h3-6,12-14,20H,7-9H2,1-2H3/t12-,13-,14-,17+/m1/s1 |
| InChIKey | MUUOKXFJOJVSEU-WBOJAVRRSA-N |
| XLogP | 2.36 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.41 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |