C19H32NO2Si+ — CID 11465844
tert-butyl-dimethyl-[(3,6,6-trimethyl-4-phenyl-4,5-dihydrooxazin-2-ium-2-yl)oxy]silane (PubChem CID 11465844) has the molecular formula C19H32NO2Si+ and a molecular weight of 334.56 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(3,6,6-trimethyl-4-phenyl-4,5-dihydrooxazin-2-ium-2-yl)oxy]silane.
| Compound Name | tert-butyl-dimethyl-[(3,6,6-trimethyl-4-phenyl-4,5-dihydrooxazin-2-ium-2-yl)oxy]silane |
|---|---|
| PubChem CID | 11465844 |
| Molecular Formula | C19H32NO2Si+ |
| Molecular Weight | 334.56 g/mol |
| Exact Mass | 334.22 |
| IUPAC Name | tert-butyl-dimethyl-[(3,6,6-trimethyl-4-phenyl-4,5-dihydrooxazin-2-ium-2-yl)oxy]silane |
| SMILES | CC1=[N+](O[Si](C)(C)C(C)(C)C)OC(C)(C)CC1c1ccccc1 |
| InChI | InChI=1S/C19H32NO2Si/c1-15-17(16-12-10-9-11-13-16)14-19(5,6)21-20(15)22-23(7,8)18(2,3)4/h9-13,17H,14H2,1-8H3/q+1 |
| InChIKey | COLVPQGURUKSPP-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 21.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.56 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|