C13H16INO2 — CID 101497519
3-(iodomethyl)-6,6-dimethyl-2-oxido-4-phenyl-4,5-dihydrooxazin-2-ium (PubChem CID 101497519) has the molecular formula C13H16INO2 and a molecular weight of 345.18 g/mol. Its IUPAC name is 3-(iodomethyl)-6,6-dimethyl-2-oxido-4-phenyl-4,5-dihydrooxazin-2-ium.
| Compound Name | 3-(iodomethyl)-6,6-dimethyl-2-oxido-4-phenyl-4,5-dihydrooxazin-2-ium |
|---|---|
| PubChem CID | 101497519 |
| Molecular Formula | C13H16INO2 |
| Molecular Weight | 345.18 g/mol |
| Exact Mass | 345.02 |
| IUPAC Name | 3-(iodomethyl)-6,6-dimethyl-2-oxido-4-phenyl-4,5-dihydrooxazin-2-ium |
| SMILES | CC1(C)CC(c2ccccc2)C(CI)=[N+]([O-])O1 |
| InChI | InChI=1S/C13H16INO2/c1-13(2)8-11(10-6-4-3-5-7-10)12(9-14)15(16)17-13/h3-7,11H,8-9H2,1-2H3 |
| InChIKey | RGCGDVXAXSTHDY-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 35.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.18 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|